C12H14Cl2O4S — CID 20802091
5-(benzenesulfonyl)-5,5-dichloro-4-methoxypentan-2-one (PubChem CID 20802091) has the molecular formula C12H14Cl2O4S and a molecular weight of 325.21 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-5,5-dichloro-4-methoxypentan-2-one.
| Compound Name | 5-(benzenesulfonyl)-5,5-dichloro-4-methoxypentan-2-one |
|---|---|
| PubChem CID | 20802091 |
| Molecular Formula | C12H14Cl2O4S |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 5-(benzenesulfonyl)-5,5-dichloro-4-methoxypentan-2-one |
| SMILES | COC(CC(C)=O)C(Cl)(Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H14Cl2O4S/c1-9(15)8-11(18-2)12(13,14)19(16,17)10-6-4-3-5-7-10/h3-7,11H,8H2,1-2H3 |
| InChIKey | ZZYZZZHLLBSVOG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|