C19H31FN2O3 — CID 22390871
N-[2-[4-[2-(4-fluorophenoxy)ethyl]piperidin-1-yl]ethyl]-2,2-dimethoxyethanamine (PubChem CID 22390871) has the molecular formula C19H31FN2O3 and a molecular weight of 354.47 g/mol. Its IUPAC name is N-[2-[4-[2-(4-fluorophenoxy)ethyl]piperidin-1-yl]ethyl]-2,2-dimethoxyethanamine.
| Compound Name | N-[2-[4-[2-(4-fluorophenoxy)ethyl]piperidin-1-yl]ethyl]-2,2-dimethoxyethanamine |
|---|---|
| PubChem CID | 22390871 |
| Molecular Formula | C19H31FN2O3 |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | N-[2-[4-[2-(4-fluorophenoxy)ethyl]piperidin-1-yl]ethyl]-2,2-dimethoxyethanamine |
| SMILES | COC(CNCCN1CCC(CCOc2ccc(F)cc2)CC1)OC |
| InChI | InChI=1S/C19H31FN2O3/c1-23-19(24-2)15-21-10-13-22-11-7-16(8-12-22)9-14-25-18-5-3-17(20)4-6-18/h3-6,16,19,21H,7-15H2,1-2H3 |
| InChIKey | USMLJDJEFYPAFR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|