C19H30FNO — CID 70054145
1-(2-ethylbutyl)-4-[2-(4-fluorophenoxy)ethyl]piperidine (PubChem CID 70054145) has the molecular formula C19H30FNO and a molecular weight of 307.45 g/mol. Its IUPAC name is 1-(2-ethylbutyl)-4-[2-(4-fluorophenoxy)ethyl]piperidine.
| Compound Name | 1-(2-ethylbutyl)-4-[2-(4-fluorophenoxy)ethyl]piperidine |
|---|---|
| PubChem CID | 70054145 |
| Molecular Formula | C19H30FNO |
| Molecular Weight | 307.45 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 1-(2-ethylbutyl)-4-[2-(4-fluorophenoxy)ethyl]piperidine |
| SMILES | CCC(CC)CN1CCC(CCOc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H30FNO/c1-3-16(4-2)15-21-12-9-17(10-13-21)11-14-22-19-7-5-18(20)6-8-19/h5-8,16-17H,3-4,9-15H2,1-2H3 |
| InChIKey | YXQIWPRXGFBJAI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |