C23H30FNO3 — CID 66995897
1-(1,1-dimethoxy-2-phenylethyl)-4-[2-(4-fluorophenoxy)ethyl]piperidine (PubChem CID 66995897) has the molecular formula C23H30FNO3 and a molecular weight of 387.50 g/mol. Its IUPAC name is 1-(1,1-dimethoxy-2-phenylethyl)-4-[2-(4-fluorophenoxy)ethyl]piperidine.
| Compound Name | 1-(1,1-dimethoxy-2-phenylethyl)-4-[2-(4-fluorophenoxy)ethyl]piperidine |
|---|---|
| PubChem CID | 66995897 |
| Molecular Formula | C23H30FNO3 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 1-(1,1-dimethoxy-2-phenylethyl)-4-[2-(4-fluorophenoxy)ethyl]piperidine |
| SMILES | COC(Cc1ccccc1)(OC)N1CCC(CCOc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H30FNO3/c1-26-23(27-2,18-20-6-4-3-5-7-20)25-15-12-19(13-16-25)14-17-28-22-10-8-21(24)9-11-22/h3-11,19H,12-18H2,1-2H3 |
| InChIKey | FGVJTJDRKVDKRO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|