C12H26O5PSe- — CID 22392399
2,2-bis(hydroxymethyl)decoxy-selenidophosphinic acid (PubChem CID 22392399) has the molecular formula C12H26O5PSe- and a molecular weight of 360.27 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)decoxy-selenidophosphinic acid.
| Compound Name | 2,2-bis(hydroxymethyl)decoxy-selenidophosphinic acid |
|---|---|
| PubChem CID | 22392399 |
| Molecular Formula | C12H26O5PSe- |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2,2-bis(hydroxymethyl)decoxy-selenidophosphinic acid |
| SMILES | CCCCCCCCC(CO)(CO)COP(=O)(O)[Se-] |
| InChI | InChI=1S/C12H27O5PSe/c1-2-3-4-5-6-7-8-12(9-13,10-14)11-17-18(15,16)19/h13-14H,2-11H2,1H3,(H2,15,16,19)/p-1 |
| InChIKey | FUPOBDQTAYEXBO-UHFFFAOYSA-M |
| XLogP | 1.99 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|