C30H56O4 — CID 22392426
12-(8-hydroxyoctyl)docosane-10,11,13-trione (PubChem CID 22392426) has the molecular formula C30H56O4 and a molecular weight of 480.77 g/mol. Its IUPAC name is 12-(8-hydroxyoctyl)docosane-10,11,13-trione.
| Compound Name | 12-(8-hydroxyoctyl)docosane-10,11,13-trione |
|---|---|
| PubChem CID | 22392426 |
| Molecular Formula | C30H56O4 |
| Molecular Weight | 480.77 g/mol |
| Exact Mass | 480.42 |
| IUPAC Name | 12-(8-hydroxyoctyl)docosane-10,11,13-trione |
| SMILES | CCCCCCCCCC(=O)C(=O)C(CCCCCCCCO)C(=O)CCCCCCCCC |
| InChI | InChI=1S/C30H56O4/c1-3-5-7-9-11-16-20-24-28(32)27(23-19-15-13-14-18-22-26-31)30(34)29(33)25-21-17-12-10-8-6-4-2/h27,31H,3-26H2,1-2H3 |
| InChIKey | LKTYDEBWAGIHGM-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.77 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|