C6H5N3O — CID 22392789
5,6-dihydropyrrolo[3,4-d]pyrimidin-7-one (PubChem CID 22392789) has the molecular formula C6H5N3O and a molecular weight of 135.13 g/mol. Its IUPAC name is 5,6-dihydropyrrolo[3,4-d]pyrimidin-7-one.
| Compound Name | 5,6-dihydropyrrolo[3,4-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 22392789 |
| Molecular Formula | C6H5N3O |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | 5,6-dihydropyrrolo[3,4-d]pyrimidin-7-one |
| SMILES | O=C1NCc2cncnc21 |
| InChI | InChI=1S/C6H5N3O/c10-6-5-4(2-8-6)1-7-3-9-5/h1,3H,2H2,(H,8,10) |
| InChIKey | GMPUYEXJACYTRP-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |