C24H33N3O2 — CID 22393375
1-(3-methoxyphenyl)-3-[3-[3-(2-phenylethyl)piperidin-1-yl]propyl]urea (PubChem CID 22393375) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-[3-[3-(2-phenylethyl)piperidin-1-yl]propyl]urea.
| Compound Name | 1-(3-methoxyphenyl)-3-[3-[3-(2-phenylethyl)piperidin-1-yl]propyl]urea |
|---|---|
| PubChem CID | 22393375 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-[3-[3-(2-phenylethyl)piperidin-1-yl]propyl]urea |
| SMILES | COc1cccc(NC(=O)NCCCN2CCCC(CCc3ccccc3)C2)c1 |
| InChI | InChI=1S/C24H33N3O2/c1-29-23-12-5-11-22(18-23)26-24(28)25-15-7-17-27-16-6-10-21(19-27)14-13-20-8-3-2-4-9-20/h2-5,8-9,11-12,18,21H,6-7,10,13-17,19H2,1H3,(H2,25,26,28) |
| InChIKey | LLXUCLCWOOURAA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|