C26H33FN2O — CID 22393705
1-(4-benzylpiperazin-1-yl)-3-[1-(4-fluorophenyl)cyclohexyl]propan-1-one (PubChem CID 22393705) has the molecular formula C26H33FN2O and a molecular weight of 408.56 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-3-[1-(4-fluorophenyl)cyclohexyl]propan-1-one.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-3-[1-(4-fluorophenyl)cyclohexyl]propan-1-one |
|---|---|
| PubChem CID | 22393705 |
| Molecular Formula | C26H33FN2O |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-3-[1-(4-fluorophenyl)cyclohexyl]propan-1-one |
| SMILES | O=C(CCC1(c2ccc(F)cc2)CCCCC1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H33FN2O/c27-24-11-9-23(10-12-24)26(14-5-2-6-15-26)16-13-25(30)29-19-17-28(18-20-29)21-22-7-3-1-4-8-22/h1,3-4,7-12H,2,5-6,13-21H2 |
| InChIKey | PXHHWTPZLMBOKN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |