C12H10N2S — CID 22397295
4-(indol-1-ylmethyl)-1,3-thiazole (PubChem CID 22397295) has the molecular formula C12H10N2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 4-(indol-1-ylmethyl)-1,3-thiazole.
| Compound Name | 4-(indol-1-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 22397295 |
| Molecular Formula | C12H10N2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 4-(indol-1-ylmethyl)-1,3-thiazole |
| SMILES | c1ccc2c(c1)ccn2Cc1cscn1 |
| InChI | InChI=1S/C12H10N2S/c1-2-4-12-10(3-1)5-6-14(12)7-11-8-15-9-13-11/h1-6,8-9H,7H2 |
| InChIKey | AFLBFGWBTUJOBK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |