C9H8N2OS — CID 115582456
1-(1,3-thiazol-4-ylmethyl)pyridin-2-one (PubChem CID 115582456) has the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. Its IUPAC name is 1-(1,3-thiazol-4-ylmethyl)pyridin-2-one.
| Compound Name | 1-(1,3-thiazol-4-ylmethyl)pyridin-2-one |
|---|---|
| PubChem CID | 115582456 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 1-(1,3-thiazol-4-ylmethyl)pyridin-2-one |
| SMILES | O=c1ccccn1Cc1cscn1 |
| InChI | InChI=1S/C9H8N2OS/c12-9-3-1-2-4-11(9)5-8-6-13-7-10-8/h1-4,6-7H,5H2 |
| InChIKey | SELQZGZAILACPZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |