C8H6IN3OS — CID 66308632
5-iodo-3-(1,3-thiazol-4-ylmethyl)pyrimidin-4-one (PubChem CID 66308632) has the molecular formula C8H6IN3OS and a molecular weight of 319.13 g/mol. Its IUPAC name is 5-iodo-3-(1,3-thiazol-4-ylmethyl)pyrimidin-4-one.
| Compound Name | 5-iodo-3-(1,3-thiazol-4-ylmethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 66308632 |
| Molecular Formula | C8H6IN3OS |
| Molecular Weight | 319.13 g/mol |
| Exact Mass | 318.93 |
| IUPAC Name | 5-iodo-3-(1,3-thiazol-4-ylmethyl)pyrimidin-4-one |
| SMILES | O=c1c(I)cncn1Cc1cscn1 |
| InChI | InChI=1S/C8H6IN3OS/c9-7-1-10-4-12(8(7)13)2-6-3-14-5-11-6/h1,3-5H,2H2 |
| InChIKey | BWLRKXPGAYTDIN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.13 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|