C15H24ClNO3 — CID 22398
butyl-[(5-ethoxy-2,3-dihydro-1,4-benzodioxin-3-yl)methyl]azanium chloride (PubChem CID 22398) has the molecular formula C15H24ClNO3 and a molecular weight of 301.81 g/mol. Its IUPAC name is butyl-[(5-ethoxy-2,3-dihydro-1,4-benzodioxin-3-yl)methyl]azanium chloride.
| Compound Name | butyl-[(5-ethoxy-2,3-dihydro-1,4-benzodioxin-3-yl)methyl]azanium chloride |
|---|---|
| PubChem CID | 22398 |
| Molecular Formula | C15H24ClNO3 |
| Molecular Weight | 301.81 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | butyl-[(5-ethoxy-2,3-dihydro-1,4-benzodioxin-3-yl)methyl]azanium chloride |
| SMILES | CCCC[NH2+]CC1COc2cccc(OCC)c2O1.[Cl-] |
| InChI | InChI=1S/C15H23NO3.ClH/c1-3-5-9-16-10-12-11-18-14-8-6-7-13(17-4-2)15(14)19-12;/h6-8,12,16H,3-5,9-11H2,1-2H3;1H |
| InChIKey | JAIBEXLQBQFZOW-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.81 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|