C24H24N4O4S — CID 22398077
2-formamido-3-[3-[1-[2-(4-phenylphenyl)acetyl]pyrrolidin-2-yl]-1,2,4-thiadiazol-5-yl]propanoic acid (PubChem CID 22398077) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is 2-formamido-3-[3-[1-[2-(4-phenylphenyl)acetyl]pyrrolidin-2-yl]-1,2,4-thiadiazol-5-yl]propanoic acid.
| Compound Name | 2-formamido-3-[3-[1-[2-(4-phenylphenyl)acetyl]pyrrolidin-2-yl]-1,2,4-thiadiazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 22398077 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 2-formamido-3-[3-[1-[2-(4-phenylphenyl)acetyl]pyrrolidin-2-yl]-1,2,4-thiadiazol-5-yl]propanoic acid |
| SMILES | O=CNC(Cc1nc(C2CCCN2C(=O)Cc2ccc(-c3ccccc3)cc2)ns1)C(=O)O |
| InChI | InChI=1S/C24H24N4O4S/c29-15-25-19(24(31)32)14-21-26-23(27-33-21)20-7-4-12-28(20)22(30)13-16-8-10-18(11-9-16)17-5-2-1-3-6-17/h1-3,5-6,8-11,15,19-20H,4,7,12-14H2,(H,25,29)(H,31,32) |
| InChIKey | JIJYRKHPTIMYDF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|