C26H25NO4 — CID 22399471
2-[1-(naphthalene-2-carbonyl)-3,6-dihydro-2H-pyridin-4-yl]-4-phenoxybutanoic acid (PubChem CID 22399471) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-[1-(naphthalene-2-carbonyl)-3,6-dihydro-2H-pyridin-4-yl]-4-phenoxybutanoic acid.
| Compound Name | 2-[1-(naphthalene-2-carbonyl)-3,6-dihydro-2H-pyridin-4-yl]-4-phenoxybutanoic acid |
|---|---|
| PubChem CID | 22399471 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 2-[1-(naphthalene-2-carbonyl)-3,6-dihydro-2H-pyridin-4-yl]-4-phenoxybutanoic acid |
| SMILES | O=C(O)C(CCOc1ccccc1)C1=CCN(C(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C26H25NO4/c28-25(22-11-10-19-6-4-5-7-21(19)18-22)27-15-12-20(13-16-27)24(26(29)30)14-17-31-23-8-2-1-3-9-23/h1-12,18,24H,13-17H2,(H,29,30) |
| InChIKey | OTORVILOESSZLB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|