C26H27NO4 — CID 54172123
2-[4-hydroxy-1-(naphthalene-2-carbonyl)piperidin-4-yl]-4-phenylbutanoic acid (PubChem CID 54172123) has the molecular formula C26H27NO4 and a molecular weight of 417.50 g/mol. Its IUPAC name is 2-[4-hydroxy-1-(naphthalene-2-carbonyl)piperidin-4-yl]-4-phenylbutanoic acid.
| Compound Name | 2-[4-hydroxy-1-(naphthalene-2-carbonyl)piperidin-4-yl]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 54172123 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 2-[4-hydroxy-1-(naphthalene-2-carbonyl)piperidin-4-yl]-4-phenylbutanoic acid |
| SMILES | O=C(O)C(CCc1ccccc1)C1(O)CCN(C(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C26H27NO4/c28-24(22-12-11-20-8-4-5-9-21(20)18-22)27-16-14-26(31,15-17-27)23(25(29)30)13-10-19-6-2-1-3-7-19/h1-9,11-12,18,23,31H,10,13-17H2,(H,29,30) |
| InChIKey | OVTIEMWWJPHLJN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |