C17H18FNO — CID 155977046
[4-(fluoromethyl)piperidin-1-yl]-naphthalen-2-ylmethanone (PubChem CID 155977046) has the molecular formula C17H18FNO and a molecular weight of 271.34 g/mol. Its IUPAC name is [4-(fluoromethyl)piperidin-1-yl]-naphthalen-2-ylmethanone.
| Compound Name | [4-(fluoromethyl)piperidin-1-yl]-naphthalen-2-ylmethanone |
|---|---|
| PubChem CID | 155977046 |
| Molecular Formula | C17H18FNO |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | [4-(fluoromethyl)piperidin-1-yl]-naphthalen-2-ylmethanone |
| SMILES | O=C(c1ccc2ccccc2c1)N1CCC(CF)CC1 |
| InChI | InChI=1S/C17H18FNO/c18-12-13-7-9-19(10-8-13)17(20)16-6-5-14-3-1-2-4-15(14)11-16/h1-6,11,13H,7-10,12H2 |
| InChIKey | XUNPZUWYBJNOED-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |