C17H18BrNO — CID 102962324
(3-bromo-4-methylpiperidin-1-yl)-naphthalen-2-ylmethanone (PubChem CID 102962324) has the molecular formula C17H18BrNO and a molecular weight of 332.24 g/mol. Its IUPAC name is (3-bromo-4-methylpiperidin-1-yl)-naphthalen-2-ylmethanone.
| Compound Name | (3-bromo-4-methylpiperidin-1-yl)-naphthalen-2-ylmethanone |
|---|---|
| PubChem CID | 102962324 |
| Molecular Formula | C17H18BrNO |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | (3-bromo-4-methylpiperidin-1-yl)-naphthalen-2-ylmethanone |
| SMILES | CC1CCN(C(=O)c2ccc3ccccc3c2)CC1Br |
| InChI | InChI=1S/C17H18BrNO/c1-12-8-9-19(11-16(12)18)17(20)15-7-6-13-4-2-3-5-14(13)10-15/h2-7,10,12,16H,8-9,11H2,1H3 |
| InChIKey | LLOPDLIZEGYJGO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|