C19H20N2O2 — CID 9389888
cyclopropyl-[4-(naphthalene-2-carbonyl)piperazin-1-yl]methanone (PubChem CID 9389888) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is cyclopropyl-[4-(naphthalene-2-carbonyl)piperazin-1-yl]methanone.
| Compound Name | cyclopropyl-[4-(naphthalene-2-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 9389888 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | cyclopropyl-[4-(naphthalene-2-carbonyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc2ccccc2c1)N1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C19H20N2O2/c22-18(15-6-7-15)20-9-11-21(12-10-20)19(23)17-8-5-14-3-1-2-4-16(14)13-17/h1-5,8,13,15H,6-7,9-12H2 |
| InChIKey | SNJSNOWIRPQDFY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |