C24H19O3P-2 — CID 22399530
[2,3-bis(2-methylphenyl)naphthalen-1-yl] phosphite (PubChem CID 22399530) has the molecular formula C24H19O3P-2 and a molecular weight of 386.39 g/mol. Its IUPAC name is [2,3-bis(2-methylphenyl)naphthalen-1-yl] phosphite.
| Compound Name | [2,3-bis(2-methylphenyl)naphthalen-1-yl] phosphite |
|---|---|
| PubChem CID | 22399530 |
| Molecular Formula | C24H19O3P-2 |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | [2,3-bis(2-methylphenyl)naphthalen-1-yl] phosphite |
| SMILES | Cc1ccccc1-c1cc2ccccc2c(OP([O-])[O-])c1-c1ccccc1C |
| InChI | InChI=1S/C24H19O3P/c1-16-9-3-6-12-19(16)22-15-18-11-5-8-14-21(18)24(27-28(25)26)23(22)20-13-7-4-10-17(20)2/h3-15H,1-2H3/q-2 |
| InChIKey | VOCFBFWTELDZGI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|