C66H63AlO3 — CID 23501597
tris[3,5-dimethyl-2,6-bis(2-methylphenyl)phenoxy]alumane (PubChem CID 23501597) has the molecular formula C66H63AlO3 and a molecular weight of 931.21 g/mol. Its IUPAC name is tris[3,5-dimethyl-2,6-bis(2-methylphenyl)phenoxy]alumane.
| Compound Name | tris[3,5-dimethyl-2,6-bis(2-methylphenyl)phenoxy]alumane |
|---|---|
| PubChem CID | 23501597 |
| Molecular Formula | C66H63AlO3 |
| Molecular Weight | 931.21 g/mol |
| Exact Mass | 930.46 |
| IUPAC Name | tris[3,5-dimethyl-2,6-bis(2-methylphenyl)phenoxy]alumane |
| SMILES | Cc1ccccc1-c1c(C)cc(C)c(-c2ccccc2C)c1O[Al](Oc1c(-c2ccccc2C)c(C)cc(C)c1-c1ccccc1C)Oc1c(-c2ccccc2C)c(C)cc(C)c1-c1ccccc1C |
| InChI | InChI=1S/3C22H22O.Al/c3*1-14-9-5-7-11-18(14)20-16(3)13-17(4)21(22(20)23)19-12-8-6-10-15(19)2;/h3*5-13,23H,1-4H3;/q;;;+3/p-3 |
| InChIKey | QMYXYRCNLNMRIH-UHFFFAOYSA-K |
| XLogP | 17.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.21 |
| LogP ≤ 5 | 17.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |