About CID 22401799
CID 22401799 (PubChem CID 22401799) has the molecular formula C7H12Cl2Si
and a molecular weight of 195.16 g/mol.
Molecular Properties
| Compound Name | CID 22401799 |
| PubChem CID | 22401799 |
| Molecular Formula | C7H12Cl2Si |
| Molecular Weight | 195.16 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | — |
| SMILES | C=CCCCC[Si]C(Cl)Cl |
| InChI | InChI=1S/C7H12Cl2Si/c1-2-3-4-5-6-10-7(8)9/h2,7H,1,3-6H2 |
| InChIKey | XMJYJYPSALDHDY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.16 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 22401799 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22401799?
The IUPAC name of CID 22401799 (CID 22401799) is not available.
What is the SMILES notation for CID 22401799?
The canonical SMILES for CID 22401799 is C=CCCCC[Si]C(Cl)Cl.
What is the InChIKey of CID 22401799?
The InChIKey is XMJYJYPSALDHDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12Cl2Si/c1-2-3-4-5-6-10-7(8)9/h2,7H,1,3-6H2.
What are the key properties of CID 22401799?
CID 22401799 has a molecular weight of 195.16 g/mol, XLogP of 3.23, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22401799 is sourced from PubChem (CID 22401799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).