C13H18Cl6Si2 — CID 22404166
trichloro-(2,4-dimethyl-3-phenyl-4-trichlorosilylpentan-2-yl)silane (PubChem CID 22404166) has the molecular formula C13H18Cl6Si2 and a molecular weight of 443.18 g/mol. Its IUPAC name is trichloro-(2,4-dimethyl-3-phenyl-4-trichlorosilylpentan-2-yl)silane.
| Compound Name | trichloro-(2,4-dimethyl-3-phenyl-4-trichlorosilylpentan-2-yl)silane |
|---|---|
| PubChem CID | 22404166 |
| Molecular Formula | C13H18Cl6Si2 |
| Molecular Weight | 443.18 g/mol |
| Exact Mass | 439.91 |
| IUPAC Name | trichloro-(2,4-dimethyl-3-phenyl-4-trichlorosilylpentan-2-yl)silane |
| SMILES | CC(C)(C(c1ccccc1)C(C)(C)[Si](Cl)(Cl)Cl)[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C13H18Cl6Si2/c1-12(2,20(14,15)16)11(10-8-6-5-7-9-10)13(3,4)21(17,18)19/h5-9,11H,1-4H3 |
| InChIKey | JGXVOHAKZZAQOX-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.18 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|