C33H28N4O7 — CID 22405292
2-[1-[4-[[2-(2,4-dimethylphenyl)benzoyl]amino]-2-nitrobenzoyl]-4-oxo-2,3-dihydro-1,5-benzodiazepin-5-yl]acetic acid (PubChem CID 22405292) has the molecular formula C33H28N4O7 and a molecular weight of 592.61 g/mol. Its IUPAC name is 2-[1-[4-[[2-(2,4-dimethylphenyl)benzoyl]amino]-2-nitrobenzoyl]-4-oxo-2,3-dihydro-1,5-benzodiazepin-5-yl]acetic acid.
| Compound Name | 2-[1-[4-[[2-(2,4-dimethylphenyl)benzoyl]amino]-2-nitrobenzoyl]-4-oxo-2,3-dihydro-1,5-benzodiazepin-5-yl]acetic acid |
|---|---|
| PubChem CID | 22405292 |
| Molecular Formula | C33H28N4O7 |
| Molecular Weight | 592.61 g/mol |
| Exact Mass | 592.20 |
| IUPAC Name | 2-[1-[4-[[2-(2,4-dimethylphenyl)benzoyl]amino]-2-nitrobenzoyl]-4-oxo-2,3-dihydro-1,5-benzodiazepin-5-yl]acetic acid |
| SMILES | Cc1ccc(-c2ccccc2C(=O)Nc2ccc(C(=O)N3CCC(=O)N(CC(=O)O)c4ccccc43)c([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C33H28N4O7/c1-20-11-13-23(21(2)17-20)24-7-3-4-8-25(24)32(41)34-22-12-14-26(29(18-22)37(43)44)33(42)35-16-15-30(38)36(19-31(39)40)28-10-6-5-9-27(28)35/h3-14,17-18H,15-16,19H2,1-2H3,(H,34,41)(H,39,40) |
| InChIKey | ATAPYWMCGONZLM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 150.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.61 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|