About barium(2+);boric acid;oxygen(2-)
barium(2+);boric acid;oxygen(2-) (PubChem CID 22406411) has the molecular formula H3BBaO4
and a molecular weight of 215.16 g/mol. Its IUPAC name is barium(2+);boric acid;oxygen(2-).
Molecular Properties
| Compound Name | barium(2+);boric acid;oxygen(2-) |
| PubChem CID | 22406411 |
| Molecular Formula | H3BBaO4 |
| Molecular Weight | 215.16 g/mol |
| Exact Mass | 215.92 |
| IUPAC Name | barium(2+);boric acid;oxygen(2-) |
| SMILES | OB(O)O.[Ba+2].[O-2] |
| InChI | InChI=1S/BH3O3.Ba.O/c2-1(3)4;;/h2-4H;;/q;+2;-2 |
| InChIKey | WAGJRKAIKYNKLV-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.16 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);boric acid;oxygen(2-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);boric acid;oxygen(2-)?
The IUPAC name of barium(2+);boric acid;oxygen(2-) (CID 22406411) is barium(2+);boric acid;oxygen(2-).
What is the SMILES notation for barium(2+);boric acid;oxygen(2-)?
The canonical SMILES for barium(2+);boric acid;oxygen(2-) is OB(O)O.[Ba+2].[O-2].
What is the InChIKey of barium(2+);boric acid;oxygen(2-)?
The InChIKey is WAGJRKAIKYNKLV-UHFFFAOYSA-N. The full InChI is InChI=1S/BH3O3.Ba.O/c2-1(3)4;;/h2-4H;;/q;+2;-2.
What are the key properties of barium(2+);boric acid;oxygen(2-)?
barium(2+);boric acid;oxygen(2-) has a molecular weight of 215.16 g/mol, XLogP of -2.55, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);boric acid;oxygen(2-) is sourced from PubChem (CID 22406411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).