C20H23BrClNO2 — CID 22406884
1-[1-(4-chlorophenyl)cyclobutyl]-2-methyl-3,4-dihydro-1H-isoquinoline-6,7-diol;hydrobromide (PubChem CID 22406884) has the molecular formula C20H23BrClNO2 and a molecular weight of 424.77 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)cyclobutyl]-2-methyl-3,4-dihydro-1H-isoquinoline-6,7-diol;hydrobromide.
| Compound Name | 1-[1-(4-chlorophenyl)cyclobutyl]-2-methyl-3,4-dihydro-1H-isoquinoline-6,7-diol;hydrobromide |
|---|---|
| PubChem CID | 22406884 |
| Molecular Formula | C20H23BrClNO2 |
| Molecular Weight | 424.77 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 1-[1-(4-chlorophenyl)cyclobutyl]-2-methyl-3,4-dihydro-1H-isoquinoline-6,7-diol;hydrobromide |
| SMILES | Br.CN1CCc2cc(O)c(O)cc2C1C1(c2ccc(Cl)cc2)CCC1 |
| InChI | InChI=1S/C20H22ClNO2.BrH/c1-22-10-7-13-11-17(23)18(24)12-16(13)19(22)20(8-2-9-20)14-3-5-15(21)6-4-14;/h3-6,11-12,19,23-24H,2,7-10H2,1H3;1H |
| InChIKey | UZXYMJUUIURMOH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.77 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|