C20H23NO5S — CID 18975700
2,6-dimethyl-1-(1-thiophen-3-ylcyclopropyl)-3,4-dihydro-1H-isoquinolin-7-ol;oxalic acid (PubChem CID 18975700) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is 2,6-dimethyl-1-(1-thiophen-3-ylcyclopropyl)-3,4-dihydro-1H-isoquinolin-7-ol;oxalic acid.
| Compound Name | 2,6-dimethyl-1-(1-thiophen-3-ylcyclopropyl)-3,4-dihydro-1H-isoquinolin-7-ol;oxalic acid |
|---|---|
| PubChem CID | 18975700 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2,6-dimethyl-1-(1-thiophen-3-ylcyclopropyl)-3,4-dihydro-1H-isoquinolin-7-ol;oxalic acid |
| SMILES | Cc1cc2c(cc1O)C(C1(c3ccsc3)CC1)N(C)CC2.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H21NOS.C2H2O4/c1-12-9-13-3-7-19(2)17(15(13)10-16(12)20)18(5-6-18)14-4-8-21-11-14;3-1(4)2(5)6/h4,8-11,17,20H,3,5-7H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | BXABLGULSVXQCI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|