C23H29NO3 — CID 143031149
ethyl 12-hydroxy-7,11-dimethyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-4-carboxylate;molecular hydrogen (PubChem CID 143031149) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is ethyl 12-hydroxy-7,11-dimethyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-4-carboxylate;molecular hydrogen.
| Compound Name | ethyl 12-hydroxy-7,11-dimethyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-4-carboxylate;molecular hydrogen |
|---|---|
| PubChem CID | 143031149 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | ethyl 12-hydroxy-7,11-dimethyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-4-carboxylate;molecular hydrogen |
| SMILES | CCOC(=O)c1cccc2c1CCC1C2c2cc(O)c(C)cc2CCN1C.[H][H] |
| InChI | InChI=1S/C23H27NO3.H2/c1-4-27-23(26)18-7-5-6-17-16(18)8-9-20-22(17)19-13-21(25)14(2)12-15(19)10-11-24(20)3;/h5-7,12-13,20,22,25H,4,8-11H2,1-3H3;1H |
| InChIKey | IPVAQDJRNQVQOI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |