C20H20ClN3O2 — CID 143031243
11-chloro-7-methyl-12-nitroso-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-4-carboxamide (PubChem CID 143031243) has the molecular formula C20H20ClN3O2 and a molecular weight of 369.85 g/mol. Its IUPAC name is 11-chloro-7-methyl-12-nitroso-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-4-carboxamide.
| Compound Name | 11-chloro-7-methyl-12-nitroso-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 143031243 |
| Molecular Formula | C20H20ClN3O2 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 11-chloro-7-methyl-12-nitroso-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-4-carboxamide |
| SMILES | CN1CCc2cc(Cl)c(N=O)cc2C2c3cccc(C(N)=O)c3CCC21 |
| InChI | InChI=1S/C20H20ClN3O2/c1-24-8-7-11-9-16(21)17(23-26)10-15(11)19-13-3-2-4-14(20(22)25)12(13)5-6-18(19)24/h2-4,9-10,18-19H,5-8H2,1H3,(H2,22,25) |
| InChIKey | HDDCCBZPONTDNW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |