C25H23Cl3N4O2 — CID 11466490
1-(11-chloro-12-hydroxy-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-4-yl)-3-(2,6-dichloro-4-pyridinyl)urea (PubChem CID 11466490) has the molecular formula C25H23Cl3N4O2 and a molecular weight of 517.84 g/mol. Its IUPAC name is 1-(11-chloro-12-hydroxy-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-4-yl)-3-(2,6-dichloro-4-pyridinyl)urea.
| Compound Name | 1-(11-chloro-12-hydroxy-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-4-yl)-3-(2,6-dichloro-4-pyridinyl)urea |
|---|---|
| PubChem CID | 11466490 |
| Molecular Formula | C25H23Cl3N4O2 |
| Molecular Weight | 517.84 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | 1-(11-chloro-12-hydroxy-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-4-yl)-3-(2,6-dichloro-4-pyridinyl)urea |
| SMILES | CN1CCc2cc(Cl)c(O)cc2C2c3cccc(NC(=O)Nc4cc(Cl)nc(Cl)c4)c3CCC21 |
| InChI | InChI=1S/C25H23Cl3N4O2/c1-32-8-7-13-9-18(26)21(33)12-17(13)24-16-3-2-4-19(15(16)5-6-20(24)32)30-25(34)29-14-10-22(27)31-23(28)11-14/h2-4,9-12,20,24,33H,5-8H2,1H3,(H2,29,30,31,34) |
| InChIKey | QJXBIXRQZLALJR-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.84 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|