C25H24ClFN2O3S — CID 11340741
N-[(6aS,13bS)-11-chloro-12-hydroxy-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-4-yl]-4-fluorobenzenesulfonamide (PubChem CID 11340741) has the molecular formula C25H24ClFN2O3S and a molecular weight of 487.00 g/mol. Its IUPAC name is N-[(6aS,13bS)-11-chloro-12-hydroxy-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-4-yl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[(6aS,13bS)-11-chloro-12-hydroxy-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-4-yl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 11340741 |
| Molecular Formula | C25H24ClFN2O3S |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | N-[(6aS,13bS)-11-chloro-12-hydroxy-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-4-yl]-4-fluorobenzenesulfonamide |
| SMILES | CN1CCc2cc(Cl)c(O)cc2[C@H]2c3cccc(NS(=O)(=O)c4ccc(F)cc4)c3CC[C@@H]21 |
| InChI | InChI=1S/C25H24ClFN2O3S/c1-29-12-11-15-13-21(26)24(30)14-20(15)25-19-3-2-4-22(18(19)9-10-23(25)29)28-33(31,32)17-7-5-16(27)6-8-17/h2-8,13-14,23,25,28,30H,9-12H2,1H3/t23-,25+/m0/s1 |
| InChIKey | XSKACBUJQWQXBL-UKILVPOCSA-N |
| XLogP | 4.92 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |