C19H21ClN2O — CID 89200446
(6aS)-2-amino-11-chloro-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-12-ol (PubChem CID 89200446) has the molecular formula C19H21ClN2O and a molecular weight of 328.84 g/mol. Its IUPAC name is (6aS)-2-amino-11-chloro-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-12-ol.
| Compound Name | (6aS)-2-amino-11-chloro-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-12-ol |
|---|---|
| PubChem CID | 89200446 |
| Molecular Formula | C19H21ClN2O |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (6aS)-2-amino-11-chloro-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-12-ol |
| SMILES | CN1CCc2cc(Cl)c(O)cc2C2c3cc(N)ccc3CC[C@@H]21 |
| InChI | InChI=1S/C19H21ClN2O/c1-22-7-6-12-8-16(20)18(23)10-15(12)19-14-9-13(21)4-2-11(14)3-5-17(19)22/h2,4,8-10,17,19,23H,3,5-7,21H2,1H3/t17-,19?/m0/s1 |
| InChIKey | VBCGWCPBBLFPLE-KKFHFHRHSA-N |
| XLogP | 3.56 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|