C19H23N3 — CID 11346901
(6aS,13bR)-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-11,12-diamine (PubChem CID 11346901) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is (6aS,13bR)-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-11,12-diamine.
| Compound Name | (6aS,13bR)-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-11,12-diamine |
|---|---|
| PubChem CID | 11346901 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | (6aS,13bR)-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-11,12-diamine |
| SMILES | CN1CCc2cc(N)c(N)cc2[C@H]2c3ccccc3CC[C@@H]21 |
| InChI | InChI=1S/C19H23N3/c1-22-9-8-13-10-16(20)17(21)11-15(13)19-14-5-3-2-4-12(14)6-7-18(19)22/h2-5,10-11,18-19H,6-9,20-21H2,1H3/t18-,19+/m0/s1 |
| InChIKey | GPSJEFYBGZHBDI-RBUKOAKNSA-N |
| XLogP | 2.79 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|