C19H19ClN4 — CID 163490615
(1R)-8-chloro-13-methyl-4,5,6,13-tetrazapentacyclo[12.8.0.02,10.03,7.017,22]docosa-2(10),3,6,8,17,19,21-heptaene (PubChem CID 163490615) has the molecular formula C19H19ClN4 and a molecular weight of 338.84 g/mol. Its IUPAC name is (1R)-8-chloro-13-methyl-4,5,6,13-tetrazapentacyclo[12.8.0.02,10.03,7.017,22]docosa-2(10),3,6,8,17,19,21-heptaene.
| Compound Name | (1R)-8-chloro-13-methyl-4,5,6,13-tetrazapentacyclo[12.8.0.02,10.03,7.017,22]docosa-2(10),3,6,8,17,19,21-heptaene |
|---|---|
| PubChem CID | 163490615 |
| Molecular Formula | C19H19ClN4 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (1R)-8-chloro-13-methyl-4,5,6,13-tetrazapentacyclo[12.8.0.02,10.03,7.017,22]docosa-2(10),3,6,8,17,19,21-heptaene |
| SMILES | CN1CCc2cc(Cl)c3n[nH]nc3c2[C@H]2c3ccccc3CCC21 |
| InChI | InChI=1S/C19H19ClN4/c1-24-9-8-12-10-14(20)18-19(22-23-21-18)16(12)17-13-5-3-2-4-11(13)6-7-15(17)24/h2-5,10,15,17H,6-9H2,1H3,(H,21,22,23)/t15?,17-/m0/s1 |
| InChIKey | CMHKHJYNAXWHIA-LWKPJOBUSA-N |
| XLogP | 3.55 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |