C26H29ClN2OS — CID 143031216
prop-2-enyl 11-chloro-12-hydroxy-7-methyl-N-prop-2-enyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-4-carboximidothioate (PubChem CID 143031216) has the molecular formula C26H29ClN2OS and a molecular weight of 453.05 g/mol. Its IUPAC name is prop-2-enyl 11-chloro-12-hydroxy-7-methyl-N-prop-2-enyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-4-carboximidothioate.
| Compound Name | prop-2-enyl 11-chloro-12-hydroxy-7-methyl-N-prop-2-enyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-4-carboximidothioate |
|---|---|
| PubChem CID | 143031216 |
| Molecular Formula | C26H29ClN2OS |
| Molecular Weight | 453.05 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | prop-2-enyl 11-chloro-12-hydroxy-7-methyl-N-prop-2-enyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-4-carboximidothioate |
| SMILES | C=CC/N=C(\SCC=C)c1cccc2c1CCC1C2c2cc(O)c(Cl)cc2CCN1C |
| InChI | InChI=1S/C26H29ClN2OS/c1-4-12-28-26(31-14-5-2)20-8-6-7-19-18(20)9-10-23-25(19)21-16-24(30)22(27)15-17(21)11-13-29(23)3/h4-8,15-16,23,25,30H,1-2,9-14H2,3H3/b28-26- |
| InChIKey | BQKYXCMRFKTYGI-SGEDCAFJSA-N |
| XLogP | 5.83 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.05 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|