C31H35N3O4 — CID 22407466
ethyl 2-[4-[[2-butyl-6-(propanoylamino)benzimidazol-1-yl]methyl]phenoxy]-2-phenylacetate (PubChem CID 22407466) has the molecular formula C31H35N3O4 and a molecular weight of 513.64 g/mol. Its IUPAC name is ethyl 2-[4-[[2-butyl-6-(propanoylamino)benzimidazol-1-yl]methyl]phenoxy]-2-phenylacetate.
| Compound Name | ethyl 2-[4-[[2-butyl-6-(propanoylamino)benzimidazol-1-yl]methyl]phenoxy]-2-phenylacetate |
|---|---|
| PubChem CID | 22407466 |
| Molecular Formula | C31H35N3O4 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | ethyl 2-[4-[[2-butyl-6-(propanoylamino)benzimidazol-1-yl]methyl]phenoxy]-2-phenylacetate |
| SMILES | CCCCc1nc2ccc(NC(=O)CC)cc2n1Cc1ccc(OC(C(=O)OCC)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H35N3O4/c1-4-7-13-28-33-26-19-16-24(32-29(35)5-2)20-27(26)34(28)21-22-14-17-25(18-15-22)38-30(31(36)37-6-3)23-11-9-8-10-12-23/h8-12,14-20,30H,4-7,13,21H2,1-3H3,(H,32,35) |
| InChIKey | DITZNRRVAHDUOR-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |