C39H41N3O6 — CID 19781922
2-[4-[[6-[benzyl(butoxycarbonyl)amino]-2-butyl-4-oxoquinazolin-3-yl]methyl]phenoxy]-2-phenylacetic acid (PubChem CID 19781922) has the molecular formula C39H41N3O6 and a molecular weight of 647.77 g/mol. Its IUPAC name is 2-[4-[[6-[benzyl(butoxycarbonyl)amino]-2-butyl-4-oxoquinazolin-3-yl]methyl]phenoxy]-2-phenylacetic acid.
| Compound Name | 2-[4-[[6-[benzyl(butoxycarbonyl)amino]-2-butyl-4-oxoquinazolin-3-yl]methyl]phenoxy]-2-phenylacetic acid |
|---|---|
| PubChem CID | 19781922 |
| Molecular Formula | C39H41N3O6 |
| Molecular Weight | 647.77 g/mol |
| Exact Mass | 647.30 |
| IUPAC Name | 2-[4-[[6-[benzyl(butoxycarbonyl)amino]-2-butyl-4-oxoquinazolin-3-yl]methyl]phenoxy]-2-phenylacetic acid |
| SMILES | CCCCOC(=O)N(Cc1ccccc1)c1ccc2nc(CCCC)n(Cc3ccc(OC(C(=O)O)c4ccccc4)cc3)c(=O)c2c1 |
| InChI | InChI=1S/C39H41N3O6/c1-3-5-17-35-40-34-23-20-31(41(39(46)47-24-6-4-2)26-28-13-9-7-10-14-28)25-33(34)37(43)42(35)27-29-18-21-32(22-19-29)48-36(38(44)45)30-15-11-8-12-16-30/h7-16,18-23,25,36H,3-6,17,24,26-27H2,1-2H3,(H,44,45) |
| InChIKey | RBZGSRKXXGMELF-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.77 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|