C34H32ClN3O7S2 — CID 54285542
N-(benzenesulfonyl)-N-[[4-[(2-butyl-6-methylsulfonyl-4-oxoquinazolin-3-yl)methyl]phenoxy]-(2-chlorophenyl)methyl]formamide (PubChem CID 54285542) has the molecular formula C34H32ClN3O7S2 and a molecular weight of 694.23 g/mol. Its IUPAC name is N-(benzenesulfonyl)-N-[[4-[(2-butyl-6-methylsulfonyl-4-oxoquinazolin-3-yl)methyl]phenoxy]-(2-chlorophenyl)methyl]formamide.
| Compound Name | N-(benzenesulfonyl)-N-[[4-[(2-butyl-6-methylsulfonyl-4-oxoquinazolin-3-yl)methyl]phenoxy]-(2-chlorophenyl)methyl]formamide |
|---|---|
| PubChem CID | 54285542 |
| Molecular Formula | C34H32ClN3O7S2 |
| Molecular Weight | 694.23 g/mol |
| Exact Mass | 693.14 |
| IUPAC Name | N-(benzenesulfonyl)-N-[[4-[(2-butyl-6-methylsulfonyl-4-oxoquinazolin-3-yl)methyl]phenoxy]-(2-chlorophenyl)methyl]formamide |
| SMILES | CCCCc1nc2ccc(S(C)(=O)=O)cc2c(=O)n1Cc1ccc(OC(c2ccccc2Cl)N(C=O)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H32ClN3O7S2/c1-3-4-14-32-36-31-20-19-27(46(2,41)42)21-29(31)33(40)37(32)22-24-15-17-25(18-16-24)45-34(28-12-8-9-13-30(28)35)38(23-39)47(43,44)26-10-6-5-7-11-26/h5-13,15-21,23,34H,3-4,14,22H2,1-2H3 |
| InChIKey | RTVDTZRCDYGDQX-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 132.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.23 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|