C22H26N4O4S — CID 22408302
1-[methyl-[4-[(2-methyl-1H-imidazo[4,5-c]pyridin-4-yl)methyl]phenyl]sulfonylamino]pent-4-en-2-yl acetate (PubChem CID 22408302) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is 1-[methyl-[4-[(2-methyl-1H-imidazo[4,5-c]pyridin-4-yl)methyl]phenyl]sulfonylamino]pent-4-en-2-yl acetate.
| Compound Name | 1-[methyl-[4-[(2-methyl-1H-imidazo[4,5-c]pyridin-4-yl)methyl]phenyl]sulfonylamino]pent-4-en-2-yl acetate |
|---|---|
| PubChem CID | 22408302 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 1-[methyl-[4-[(2-methyl-1H-imidazo[4,5-c]pyridin-4-yl)methyl]phenyl]sulfonylamino]pent-4-en-2-yl acetate |
| SMILES | C=CCC(CN(C)S(=O)(=O)c1ccc(Cc2nccc3[nH]c(C)nc23)cc1)OC(C)=O |
| InChI | InChI=1S/C22H26N4O4S/c1-5-6-18(30-16(3)27)14-26(4)31(28,29)19-9-7-17(8-10-19)13-21-22-20(11-12-23-21)24-15(2)25-22/h5,7-12,18H,1,6,13-14H2,2-4H3,(H,24,25) |
| InChIKey | SGBCGFIVJTWWDS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|