About (3-tert-butylperoxy-3-methylbutyl) 2-sulfanylnonanoate
(3-tert-butylperoxy-3-methylbutyl) 2-sulfanylnonanoate (PubChem CID 22408814) has the molecular formula C18H36O4S
and a molecular weight of 348.55 g/mol. Its IUPAC name is (3-tert-butylperoxy-3-methylbutyl) 2-sulfanylnonanoate.
Molecular Properties
| Compound Name | (3-tert-butylperoxy-3-methylbutyl) 2-sulfanylnonanoate |
| PubChem CID | 22408814 |
| Molecular Formula | C18H36O4S |
| Molecular Weight | 348.55 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (3-tert-butylperoxy-3-methylbutyl) 2-sulfanylnonanoate |
| SMILES | CCCCCCCC(S)C(=O)OCCC(C)(C)OOC(C)(C)C |
| InChI | InChI=1S/C18H36O4S/c1-7-8-9-10-11-12-15(23)16(19)20-14-13-18(5,6)22-21-17(2,3)4/h15,23H,7-14H2,1-6H3 |
| InChIKey | RTEQHJIXSLXXPP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3-tert-butylperoxy-3-methylbutyl) 2-sulfanylnonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-tert-butylperoxy-3-methylbutyl) 2-sulfanylnonanoate?
The IUPAC name of (3-tert-butylperoxy-3-methylbutyl) 2-sulfanylnonanoate (CID 22408814) is (3-tert-butylperoxy-3-methylbutyl) 2-sulfanylnonanoate.
What is the SMILES notation for (3-tert-butylperoxy-3-methylbutyl) 2-sulfanylnonanoate?
The canonical SMILES for (3-tert-butylperoxy-3-methylbutyl) 2-sulfanylnonanoate is CCCCCCCC(S)C(=O)OCCC(C)(C)OOC(C)(C)C.
What is the InChIKey of (3-tert-butylperoxy-3-methylbutyl) 2-sulfanylnonanoate?
The InChIKey is RTEQHJIXSLXXPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O4S/c1-7-8-9-10-11-12-15(23)16(19)20-14-13-18(5,6)22-21-17(2,3)4/h15,23H,7-14H2,1-6H3.
What are the key properties of (3-tert-butylperoxy-3-methylbutyl) 2-sulfanylnonanoate?
(3-tert-butylperoxy-3-methylbutyl) 2-sulfanylnonanoate has a molecular weight of 348.55 g/mol, XLogP of 5.10, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-tert-butylperoxy-3-methylbutyl) 2-sulfanylnonanoate is sourced from PubChem (CID 22408814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).