C30H33N3O2 — CID 22412778
2-(6-octoxy-3-pyridinyl)-5-(4-phenylmethoxyphenyl)pyrazine (PubChem CID 22412778) has the molecular formula C30H33N3O2 and a molecular weight of 467.61 g/mol. Its IUPAC name is 2-(6-octoxy-3-pyridinyl)-5-(4-phenylmethoxyphenyl)pyrazine.
| Compound Name | 2-(6-octoxy-3-pyridinyl)-5-(4-phenylmethoxyphenyl)pyrazine |
|---|---|
| PubChem CID | 22412778 |
| Molecular Formula | C30H33N3O2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 2-(6-octoxy-3-pyridinyl)-5-(4-phenylmethoxyphenyl)pyrazine |
| SMILES | CCCCCCCCOc1ccc(-c2cnc(-c3ccc(OCc4ccccc4)cc3)cn2)cn1 |
| InChI | InChI=1S/C30H33N3O2/c1-2-3-4-5-6-10-19-34-30-18-15-26(20-33-30)29-22-31-28(21-32-29)25-13-16-27(17-14-25)35-23-24-11-8-7-9-12-24/h7-9,11-18,20-22H,2-6,10,19,23H2,1H3 |
| InChIKey | XAICIJYTVUFWCH-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|