C24H28N2O3 — CID 22415344
N,N-dibenzyl-2-[6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetamide (PubChem CID 22415344) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is N,N-dibenzyl-2-[6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetamide.
| Compound Name | N,N-dibenzyl-2-[6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetamide |
|---|---|
| PubChem CID | 22415344 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N,N-dibenzyl-2-[6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetamide |
| SMILES | CC1(C)OC(CC#N)CC(CC(=O)N(Cc2ccccc2)Cc2ccccc2)O1 |
| InChI | InChI=1S/C24H28N2O3/c1-24(2)28-21(13-14-25)15-22(29-24)16-23(27)26(17-19-9-5-3-6-10-19)18-20-11-7-4-8-12-20/h3-12,21-22H,13,15-18H2,1-2H3 |
| InChIKey | HBBDNWBNKMBENR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |