C17H18ClN3O3S — CID 22417959
N-[4-(3-methoxyanilino)quinolin-8-yl]methanesulfonamide;hydrochloride (PubChem CID 22417959) has the molecular formula C17H18ClN3O3S and a molecular weight of 379.87 g/mol. Its IUPAC name is N-[4-(3-methoxyanilino)quinolin-8-yl]methanesulfonamide;hydrochloride.
| Compound Name | N-[4-(3-methoxyanilino)quinolin-8-yl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 22417959 |
| Molecular Formula | C17H18ClN3O3S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | N-[4-(3-methoxyanilino)quinolin-8-yl]methanesulfonamide;hydrochloride |
| SMILES | COc1cccc(Nc2ccnc3c(NS(C)(=O)=O)cccc23)c1.Cl |
| InChI | InChI=1S/C17H17N3O3S.ClH/c1-23-13-6-3-5-12(11-13)19-15-9-10-18-17-14(15)7-4-8-16(17)20-24(2,21)22;/h3-11,20H,1-2H3,(H,18,19);1H |
| InChIKey | ZYTXPXMELRAYHG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |