C16H15ClN2O3 — CID 22417967
4-(3-methoxyanilino)quinoline-6,8-diol;hydrochloride (PubChem CID 22417967) has the molecular formula C16H15ClN2O3 and a molecular weight of 318.76 g/mol. Its IUPAC name is 4-(3-methoxyanilino)quinoline-6,8-diol;hydrochloride.
| Compound Name | 4-(3-methoxyanilino)quinoline-6,8-diol;hydrochloride |
|---|---|
| PubChem CID | 22417967 |
| Molecular Formula | C16H15ClN2O3 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 4-(3-methoxyanilino)quinoline-6,8-diol;hydrochloride |
| SMILES | COc1cccc(Nc2ccnc3c(O)cc(O)cc23)c1.Cl |
| InChI | InChI=1S/C16H14N2O3.ClH/c1-21-12-4-2-3-10(7-12)18-14-5-6-17-16-13(14)8-11(19)9-15(16)20;/h2-9,19-20H,1H3,(H,17,18);1H |
| InChIKey | UFFCDTTURRWYQG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |