C7H17Cl2N2O3P — CID 22420
N,N-bis(2-chloroethyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine;hydrate (PubChem CID 22420) has the molecular formula C7H17Cl2N2O3P and a molecular weight of 279.10 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine;hydrate.
| Compound Name | N,N-bis(2-chloroethyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine;hydrate |
|---|---|
| PubChem CID | 22420 |
| Molecular Formula | C7H17Cl2N2O3P |
| Molecular Weight | 279.10 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | N,N-bis(2-chloroethyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine;hydrate |
| SMILES | O.O=P1(N(CCCl)CCCl)NCCCO1 |
| InChI | InChI=1S/C7H15Cl2N2O2P.H2O/c8-2-5-11(6-3-9)14(12)10-4-1-7-13-14;/h1-7H2,(H,10,12);1H2 |
| InChIKey | PWOQRKCAHTVFLB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.10 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|