C7H15Cl2N2O2P — CID 2907
View drug profile → cyclophosphamideN,N-bis(2-chloroethyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine (PubChem CID 2907) has the molecular formula C7H15Cl2N2O2P and a molecular weight of 261.09 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine.
| Compound Name | N,N-bis(2-chloroethyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine |
|---|---|
| PubChem CID | 2907 |
| Molecular Formula | C7H15Cl2N2O2P |
| Molecular Weight | 261.09 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | N,N-bis(2-chloroethyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine |
| SMILES | O=P1(N(CCCl)CCCl)NCCCO1 |
| InChI | InChI=1S/C7H15Cl2N2O2P/c8-2-5-11(6-3-9)14(12)10-4-1-7-13-14/h1-7H2,(H,10,12) |
| InChIKey | CMSMOCZEIVJLDB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.09 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|