C14H19BrS2 — CID 22421012
2-(4-bromophenyl)-5-tert-butyl-1,3-dithiane (PubChem CID 22421012) has the molecular formula C14H19BrS2 and a molecular weight of 331.34 g/mol. Its IUPAC name is 2-(4-bromophenyl)-5-tert-butyl-1,3-dithiane.
| Compound Name | 2-(4-bromophenyl)-5-tert-butyl-1,3-dithiane |
|---|---|
| PubChem CID | 22421012 |
| Molecular Formula | C14H19BrS2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 2-(4-bromophenyl)-5-tert-butyl-1,3-dithiane |
| SMILES | CC(C)(C)C1CSC(c2ccc(Br)cc2)SC1 |
| InChI | InChI=1S/C14H19BrS2/c1-14(2,3)11-8-16-13(17-9-11)10-4-6-12(15)7-5-10/h4-7,11,13H,8-9H2,1-3H3 |
| InChIKey | CGDRQCPHUMDROP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |