C27H25FN4O2 — CID 22422387
[4-(4-fluorophenyl)piperazin-1-yl]-[1-(2-methoxyanilino)isoquinolin-4-yl]methanone (PubChem CID 22422387) has the molecular formula C27H25FN4O2 and a molecular weight of 456.52 g/mol. Its IUPAC name is [4-(4-fluorophenyl)piperazin-1-yl]-[1-(2-methoxyanilino)isoquinolin-4-yl]methanone.
| Compound Name | [4-(4-fluorophenyl)piperazin-1-yl]-[1-(2-methoxyanilino)isoquinolin-4-yl]methanone |
|---|---|
| PubChem CID | 22422387 |
| Molecular Formula | C27H25FN4O2 |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | [4-(4-fluorophenyl)piperazin-1-yl]-[1-(2-methoxyanilino)isoquinolin-4-yl]methanone |
| SMILES | COc1ccccc1Nc1ncc(C(=O)N2CCN(c3ccc(F)cc3)CC2)c2ccccc12 |
| InChI | InChI=1S/C27H25FN4O2/c1-34-25-9-5-4-8-24(25)30-26-22-7-3-2-6-21(22)23(18-29-26)27(33)32-16-14-31(15-17-32)20-12-10-19(28)11-13-20/h2-13,18H,14-17H2,1H3,(H,29,30) |
| InChIKey | AUBWLLPRCUPMNO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |