C30H31ClN4O — CID 22334363
[1-(3-chloro-4-methylanilino)isoquinolin-4-yl]-[4-(4-propan-2-ylphenyl)piperazin-1-yl]methanone (PubChem CID 22334363) has the molecular formula C30H31ClN4O and a molecular weight of 499.06 g/mol. Its IUPAC name is [1-(3-chloro-4-methylanilino)isoquinolin-4-yl]-[4-(4-propan-2-ylphenyl)piperazin-1-yl]methanone.
| Compound Name | [1-(3-chloro-4-methylanilino)isoquinolin-4-yl]-[4-(4-propan-2-ylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 22334363 |
| Molecular Formula | C30H31ClN4O |
| Molecular Weight | 499.06 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | [1-(3-chloro-4-methylanilino)isoquinolin-4-yl]-[4-(4-propan-2-ylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(Nc2ncc(C(=O)N3CCN(c4ccc(C(C)C)cc4)CC3)c3ccccc23)cc1Cl |
| InChI | InChI=1S/C30H31ClN4O/c1-20(2)22-9-12-24(13-10-22)34-14-16-35(17-15-34)30(36)27-19-32-29(26-7-5-4-6-25(26)27)33-23-11-8-21(3)28(31)18-23/h4-13,18-20H,14-17H2,1-3H3,(H,32,33) |
| InChIKey | WHEXKQDXVBEKTN-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.06 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|