C29H28ClN3O — CID 22334347
(4-benzylpiperidin-1-yl)-[1-(3-chloro-4-methylanilino)isoquinolin-4-yl]methanone (PubChem CID 22334347) has the molecular formula C29H28ClN3O and a molecular weight of 470.02 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[1-(3-chloro-4-methylanilino)isoquinolin-4-yl]methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-[1-(3-chloro-4-methylanilino)isoquinolin-4-yl]methanone |
|---|---|
| PubChem CID | 22334347 |
| Molecular Formula | C29H28ClN3O |
| Molecular Weight | 470.02 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[1-(3-chloro-4-methylanilino)isoquinolin-4-yl]methanone |
| SMILES | Cc1ccc(Nc2ncc(C(=O)N3CCC(Cc4ccccc4)CC3)c3ccccc23)cc1Cl |
| InChI | InChI=1S/C29H28ClN3O/c1-20-11-12-23(18-27(20)30)32-28-25-10-6-5-9-24(25)26(19-31-28)29(34)33-15-13-22(14-16-33)17-21-7-3-2-4-8-21/h2-12,18-19,22H,13-17H2,1H3,(H,31,32) |
| InChIKey | JSGAJYFSCSIYJS-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.02 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |